Products 20807-05-0

CAS 20807-05-0 is the registry number for (S)-2-(((Benzyloxy)carbonyl)amino)-6-formamidohexanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-formamido-2-(phenylmethoxycarbonylamino)hexanoic acid (CAS 20807-05-0) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: 6-formamido-2-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: WQGAAAXDBHLCJF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20N2O5
Molecular weight308.33 g/mol
IUPAC name6-formamido-2-(phenylmethoxycarbonylamino)hexanoic acid
InChIKeyWQGAAAXDBHLCJF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC(CCCCNC=O)C(=O)O

Computed by PubChem (NCBI)