CAS 208107-14-6 appears in our catalog under these names: Temozolomide-d3, Temozolomide–d3, Temozolomide-d3, 99.87%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 500μg, 1 mg.
4-oxo-3-(trideuteriomethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (CAS 208107-14-6) is a chemical compound with the molecular formula C6H6N6O2 and a molecular weight of 197.17 g/mol. IUPAC name: 4-oxo-3-(trideuteriomethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide. InChIKey: BPEGJWRSRHCHSN-FIBGUPNXSA-N.
| Molecular formula | C6H6N6O2 |
|---|---|
| Molecular weight | 197.17 g/mol |
| IUPAC name | 4-oxo-3-(trideuteriomethyl)imidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| InChIKey | BPEGJWRSRHCHSN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)N2C=NC(=C2N=N1)C(=O)N |
Computed by PubChem (NCBI)