CAS 208108-76-3 appears in our catalog under these names: 4-Phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid, 95%, 4-Phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid, 97%, 4-Phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid, 95% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 1g, 5g, 250mg.
4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 208108-76-3) is a chemical compound with the molecular formula C12H7F3O2S and a molecular weight of 272.24 g/mol. IUPAC name: 4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: GIUAGKGTDDIMHB-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O2S |
|---|---|
| Molecular weight | 272.24 g/mol |
| IUPAC name | 4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylic acid |
| InChIKey | GIUAGKGTDDIMHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)