CAS 2340293-28-7 appears in our catalog under these names: 4-(Thiophen-3-yl)-3-(trifluoromethyl)benzoic acid, 95%, 4–(Thiophen–3–yl)–3–(trifluoromethyl)benzoic acid, 4-(Thiophen-3-yl)-3-(trifluoromethyl)benzoic acid, 97%, 97%, 4-(Thiophen-3-yl)-3-(trifluoromethyl)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 50mg.
4-thiophen-3-yl-3-(trifluoromethyl)benzoic acid (CAS 2340293-28-7) is a chemical compound with the molecular formula C12H7F3O2S and a molecular weight of 272.24 g/mol. IUPAC name: 4-thiophen-3-yl-3-(trifluoromethyl)benzoic acid. InChIKey: CMMVEZZYOACBRY-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O2S |
|---|---|
| Molecular weight | 272.24 g/mol |
| IUPAC name | 4-thiophen-3-yl-3-(trifluoromethyl)benzoic acid |
| InChIKey | CMMVEZZYOACBRY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)C2=CSC=C2 |
Computed by PubChem (NCBI)