CAS 208122-06-9 is the registry number for Enzalutamide Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
4-(methylamino)-2-(trifluoromethyl)benzonitrile (CAS 208122-06-9) is a chemical compound with the molecular formula C9H7F3N2 and a molecular weight of 200.16 g/mol. IUPAC name: 4-(methylamino)-2-(trifluoromethyl)benzonitrile. InChIKey: ZOOQTZBWYPVCFN-UHFFFAOYSA-N.
| Molecular formula | C9H7F3N2 |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 4-(methylamino)-2-(trifluoromethyl)benzonitrile |
| InChIKey | ZOOQTZBWYPVCFN-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)