CAS 20821-91-4 appears in our catalog under these names: N-(2-Benzoyl-4-nitrophenyl)-2-chloro-acetamide, Nitrazepam Impurity 1. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
N-(2-benzoyl-4-nitrophenyl)-2-chloroacetamide (CAS 20821-91-4) is a chemical compound with the molecular formula C15H11ClN2O4 and a molecular weight of 318.71 g/mol. IUPAC name: N-(2-benzoyl-4-nitrophenyl)-2-chloroacetamide. InChIKey: ZHJLHAOWFYEIOC-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2O4 |
|---|---|
| Molecular weight | 318.71 g/mol |
| IUPAC name | N-(2-benzoyl-4-nitrophenyl)-2-chloroacetamide |
| InChIKey | ZHJLHAOWFYEIOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)CCl |
Computed by PubChem (NCBI)