Products 304456-80-2

CAS 304456-80-2 is the registry number for 2-(2-(3-Chlorobenzoyl)hydrazine-1-carbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(3-chlorobenzoyl)amino]carbamoyl]benzoic acid (CAS 304456-80-2) is a chemical compound with the molecular formula C15H11ClN2O4 and a molecular weight of 318.71 g/mol. IUPAC name: 2-[[(3-chlorobenzoyl)amino]carbamoyl]benzoic acid. InChIKey: LFHSSCMCMHCBTA-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11ClN2O4
Molecular weight318.71 g/mol
IUPAC name2-[[(3-chlorobenzoyl)amino]carbamoyl]benzoic acid
InChIKeyLFHSSCMCMHCBTA-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NNC(=O)C2=CC(=CC=C2)Cl)C(=O)O

Computed by PubChem (NCBI)