Products 208259-49-8
CAS 208259-49-8 appears in our catalog under these names: ethyl 2–(3，5–difluorophenyl)–2，2–difluoroacetate, Ethyl (3,5-Difluorophenyl)-difluoroacetate, Ethyl-2,2-difluoro-2-(3,5-difluorophenyl)acetate, 90%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
Ethyl 2-(3,5-difluorophenyl)-2,2-difluoroacetate (CAS 208259-49-8) is a chemical compound with the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. IUPAC name: ethyl 2-(3,5-difluorophenyl)-2,2-difluoroacetate. InChIKey: RDMLTCOKHPCPJA-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | ethyl 2-(3,5-difluorophenyl)-2,2-difluoroacetate |
| InChIKey | RDMLTCOKHPCPJA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=CC(=C1)F)F)(F)F |
Computed by PubChem (NCBI)