Products 2082699-21-4
CAS 2082699-21-4 is the registry number for N'-(2-Bromo-4-methylbenzylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
N-[(Z)-(2-bromo-4-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2082699-21-4) is a chemical compound with the molecular formula C15H15BrN2O2S and a molecular weight of 367.3 g/mol. IUPAC name: N-[(Z)-(2-bromo-4-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: ULOXIQIJFMHPQS-YVLHZVERSA-N.
| Molecular formula | C15H15BrN2O2S |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | N-[(Z)-(2-bromo-4-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | ULOXIQIJFMHPQS-YVLHZVERSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C\C2=C(C=C(C=C2)C)Br |
Computed by PubChem (NCBI)