CAS 75230-52-3 appears in our catalog under these names: N'–(1–(3–bromophenyl)ethylidene)–4–methylbenzenesulfonohydrazide, 4-Methylbenzenesulfonic acid 2-[1-(3-bromophenyl)ethylidene]hydrazide, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
N-[(E)-1-(3-bromophenyl)ethylideneamino]-4-methylbenzenesulfonamide (CAS 75230-52-3) is a chemical compound with the molecular formula C15H15BrN2O2S and a molecular weight of 367.3 g/mol. IUPAC name: N-[(E)-1-(3-bromophenyl)ethylideneamino]-4-methylbenzenesulfonamide. InChIKey: NFIMDMPKBKXVCH-SFQUDFHCSA-N.
| Molecular formula | C15H15BrN2O2S |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | N-[(E)-1-(3-bromophenyl)ethylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | NFIMDMPKBKXVCH-SFQUDFHCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C(\C)/C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)