CAS 208390-39-0 appears in our catalog under these names: 2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane, tech grade, 90%, 2–(3,4–Dimethylphenyl)–1,3,2–dioxaborinane, 2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane 90%, 2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane, tech grade, 90%, 90%, 2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane, 90%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane (CAS 208390-39-0) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane. InChIKey: CCIUKBNSPVDPBE-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | CCIUKBNSPVDPBE-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=C(C=C2)C)C |
Computed by PubChem (NCBI)