2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane, 90%
cas: 208390-39-0 — see every product listed under this CAS number, including other names
2-(3,4-Dimethylphenyl)-1,3,2-dioxaborinane, 90% (CAS 208390-39-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A567451-250mg |
| cas | 208390-39-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 337.00 Pln | |
| BLDpharm | 250mg | 147.75 Pln | |
| BLDpharm | 1g | 164.41 Pln | |
| BLDpharm | 5g | 303.25 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 804.94 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane (CAS 208390-39-0) is a chemical compound with the molecular formula C11H15BO2 and a molecular weight of 190.05 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane. InChIKey: CCIUKBNSPVDPBE-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-1,3,2-dioxaborinane |
| InChIKey | CCIUKBNSPVDPBE-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=C(C=C2)C)C |
Computed by PubChem (NCBI)