Products 20845-16-3
CAS 20845-16-3 appears in our catalog under these names: H-Glu(oall)-oall p-tosylate, 98%, L-Glutamic acid diallyl ester tosylate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 100g, 25g.
Bis(prop-2-enyl) (2S)-2-aminopentanedioate;4-methylbenzenesulfonic acid (CAS 20845-16-3) is a chemical compound with the molecular formula C18H25NO7S and a molecular weight of 399.5 g/mol. IUPAC name: bis(prop-2-enyl) (2S)-2-aminopentanedioate;4-methylbenzenesulfonic acid. InChIKey: CXIWDQLHGWDUTO-FVGYRXGTSA-N.
| Molecular formula | C18H25NO7S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | bis(prop-2-enyl) (2S)-2-aminopentanedioate;4-methylbenzenesulfonic acid |
| InChIKey | CXIWDQLHGWDUTO-FVGYRXGTSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CCOC(=O)CC[C@@H](C(=O)OCC=C)N |
Computed by PubChem (NCBI)
Synonyms:
H-Glu(oall)-oall p-tosylate, H-Glu(OAll)-OAll.TosOH, (S)-diallyl 2-aminopentanedioate 4-methylbenzenesulfonate, bis(prop-2-enyl) (2S)-2-aminopentanedioate;4-methylbenzenesulfonic acid, L-Glutamic acid diallyl ester tosylate, CXIWDQLHGWDUTO-FVGYRXGTSA-N, diallyl L-glutamate p-toluene sulfonate, L-Glutamic acid diallyl ester (tosylate), diallyl (2S)-2-aminopentanedioate;4-methylbenzenesulfonic acid, L-Glutamic acid diallyl ester tosylate (H-L-Glu(OAll)-OAll.TsOH)