CAS 88043-21-4 appears in our catalog under these names: Boc–trans–4–Tosyloxy–L–proline methyl ester, trans-N-tert-Butyloxycarbonyl-4-tosyloxy-L-proline Methyl Ester, N-(tert-Butoxycarbonyl)-trans-4-(p-toluenesulfonyloxy)-L-proline Methyl Ester, >98.0%(HPLC)(N), Boc-Hyp(Tos)-OMe 95%, N-Boc-trans-4-tosyloxy-L-proline methyl ester, 95%, 95%. Offered by: GLPBio, TRC, TCI, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 100mg, 250mg, 50mg, 200mg, 1g, 25g.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate (CAS 88043-21-4) is a chemical compound with the molecular formula C18H25NO7S and a molecular weight of 399.5 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate. InChIKey: UKVKNGDXVREPDE-HIFRSBDPSA-N.
| Molecular formula | C18H25NO7S |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
| InChIKey | UKVKNGDXVREPDE-HIFRSBDPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@@H]2C[C@H](N(C2)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)