Products 2084913-47-1

CAS 2084913-47-1 is the registry number for H-L-Lys(3-N3-Z)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride (CAS 2084913-47-1) is a chemical compound with the molecular formula C14H20ClN5O4 and a molecular weight of 357.79 g/mol. IUPAC name: (2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride. InChIKey: ZHDVIWUJPIGVCD-YDALLXLXSA-N.

Identity
Molecular formulaC14H20ClN5O4
Molecular weight357.79 g/mol
IUPAC name(2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride
InChIKeyZHDVIWUJPIGVCD-YDALLXLXSA-N
SMILESC1=CC(=CC(=C1)N=[N+]=[N-])COC(=O)NCCCC[C@@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)