CAS 2084913-47-1 is the registry number for H-L-Lys(3-N3-Z)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
(2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride (CAS 2084913-47-1) is a chemical compound with the molecular formula C14H20ClN5O4 and a molecular weight of 357.79 g/mol. IUPAC name: (2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride. InChIKey: ZHDVIWUJPIGVCD-YDALLXLXSA-N.
| Molecular formula | C14H20ClN5O4 |
|---|---|
| Molecular weight | 357.79 g/mol |
| IUPAC name | (2S)-2-amino-6-[(3-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride |
| InChIKey | ZHDVIWUJPIGVCD-YDALLXLXSA-N |
| SMILES | C1=CC(=CC(=C1)N=[N+]=[N-])COC(=O)NCCCC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)