CAS 2084913-49-3 appears in our catalog under these names: H–L–Lys(4–N3–Z)–OH hydrochloride, H-L-Lys(4-N3-Z)-OH*HCl, H-L-Lys(4-N3-Z)-OH (hydrochloride), 99.69%. Offered by: GLPBio, Iris Biotech, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 500mg, 1g.
(2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride (CAS 2084913-49-3) is a chemical compound with the molecular formula C14H20ClN5O4 and a molecular weight of 357.79 g/mol. IUPAC name: (2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride. InChIKey: AQUASNYNCOKBBC-YDALLXLXSA-N.
| Molecular formula | C14H20ClN5O4 |
|---|---|
| Molecular weight | 357.79 g/mol |
| IUPAC name | (2S)-2-amino-6-[(4-azidophenyl)methoxycarbonylamino]hexanoic acid;hydrochloride |
| InChIKey | AQUASNYNCOKBBC-YDALLXLXSA-N |
| SMILES | C1=CC(=CC=C1COC(=O)NCCCC[C@@H](C(=O)O)N)N=[N+]=[N-].Cl |
Computed by PubChem (NCBI)