CAS 208510-03-6 appears in our catalog under these names: 4-Nitroimidazole-5-carbonitrile, 95%, 4–Nitroimidazole–5–carbonitrile, 4-Nitro-1H-imidazole-5-carbonitrile, >97%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-nitro-1H-imidazole-4-carbonitrile (CAS 208510-03-6) is a chemical compound with the molecular formula C4H2N4O2 and a molecular weight of 138.08 g/mol. IUPAC name: 5-nitro-1H-imidazole-4-carbonitrile. InChIKey: UNHKJVQFVZYKRW-UHFFFAOYSA-N.
| Molecular formula | C4H2N4O2 |
|---|---|
| Molecular weight | 138.08 g/mol |
| IUPAC name | 5-nitro-1H-imidazole-4-carbonitrile |
| InChIKey | UNHKJVQFVZYKRW-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)