Products 26663-11-6

CAS 26663-11-6 is the registry number for 5-Cyano-1H-1,2,4-triazole-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-cyano-1H-1,2,4-triazole-5-carboxylic acid (CAS 26663-11-6) is a chemical compound with the molecular formula C4H2N4O2 and a molecular weight of 138.08 g/mol. IUPAC name: 3-cyano-1H-1,2,4-triazole-5-carboxylic acid. InChIKey: DZBDQPNFNJVALH-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2N4O2
Molecular weight138.08 g/mol
IUPAC name3-cyano-1H-1,2,4-triazole-5-carboxylic acid
InChIKeyDZBDQPNFNJVALH-UHFFFAOYSA-N
SMILESC(#N)C1=NNC(=N1)C(=O)O

Computed by PubChem (NCBI)