CAS 208521-24-8 is the registry number for endo-MGK 264. Offered by: Dr. Ehrenstorfer. Available pack sizes: 25mg.
(1R,2S,6R,7S)-4-(2-ethylhexyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (CAS 208521-24-8) is a chemical compound with the molecular formula C17H25NO2 and a molecular weight of 275.4 g/mol. IUPAC name: (1R,2S,6R,7S)-4-(2-ethylhexyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione. InChIKey: WLLGXSLBOPFWQV-LFAHVKQVSA-N.
| Molecular formula | C17H25NO2 |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | (1R,2S,6R,7S)-4-(2-ethylhexyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| InChIKey | WLLGXSLBOPFWQV-LFAHVKQVSA-N |
| SMILES | CCCCC(CC)CN1C(=O)[C@H]2[C@@H]3C[C@H]([C@H]2C1=O)C=C3 |
Computed by PubChem (NCBI)