CAS 2085791-77-9 is the registry number for 5,5-Dimethyl-2-(methylsulfonyl)-5,7-dihydro-6H-pyrrolo(2,3-d)pyrimidin-6-one, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5,5-dimethyl-2-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidin-6-one (CAS 2085791-77-9) is a chemical compound with the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. IUPAC name: 5,5-dimethyl-2-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidin-6-one. InChIKey: UGJUGRIZVHOBDA-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O3S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 5,5-dimethyl-2-methylsulfonyl-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| InChIKey | UGJUGRIZVHOBDA-UHFFFAOYSA-N |
| SMILES | CC1(C2=CN=C(N=C2NC1=O)S(=O)(=O)C)C |
Computed by PubChem (NCBI)