CAS 24134-67-6 is the registry number for 1,3-Dimethyl-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (CAS 24134-67-6) is a chemical compound with the molecular formula C9H11N3O3S and a molecular weight of 241.27 g/mol. IUPAC name: 1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide. InChIKey: LNMRRGFCIHIANW-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O3S |
|---|---|
| Molecular weight | 241.27 g/mol |
| IUPAC name | 1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| InChIKey | LNMRRGFCIHIANW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N)N(C1=O)C |
Computed by PubChem (NCBI)