Products 208775-27-3

CAS 208775-27-3 appears in our catalog under these names: 2,4-Dimethylthiophene-3-sulfonyl chloride, 2,4-Dimethylthiophene-3-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

2,4-dimethylthiophene-3-sulfonyl chloride (CAS 208775-27-3) is a chemical compound with the molecular formula C6H7ClO2S2 and a molecular weight of 210.7 g/mol. IUPAC name: 2,4-dimethylthiophene-3-sulfonyl chloride. InChIKey: IEDRPAKLFWDQRC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClO2S2
Molecular weight210.7 g/mol
IUPAC name2,4-dimethylthiophene-3-sulfonyl chloride
InChIKeyIEDRPAKLFWDQRC-UHFFFAOYSA-N
SMILESCC1=CSC(=C1S(=O)(=O)Cl)C

Computed by PubChem (NCBI)