Products 405308-14-7

CAS 405308-14-7 is the registry number for 2-(Thiophen-2-yl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-thiophen-2-ylethanesulfonyl chloride (CAS 405308-14-7) is a chemical compound with the molecular formula C6H7ClO2S2 and a molecular weight of 210.7 g/mol. IUPAC name: 2-thiophen-2-ylethanesulfonyl chloride. InChIKey: NYTNMUXNWRMSDC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClO2S2
Molecular weight210.7 g/mol
IUPAC name2-thiophen-2-ylethanesulfonyl chloride
InChIKeyNYTNMUXNWRMSDC-UHFFFAOYSA-N
SMILESC1=CSC(=C1)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)