Products 2088247-61-2
CAS 2088247-61-2 appears in our catalog under these names: SP–8008, SP-8008. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 100mg, 50mg, Get quote.
(2-ethyl-4-oxopyran-3-yl) 4-hydroxy-3-methoxybenzoate (CAS 2088247-61-2) is a chemical compound with the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. IUPAC name: (2-ethyl-4-oxopyran-3-yl) 4-hydroxy-3-methoxybenzoate. InChIKey: NHGPHSDMEIUFCL-UHFFFAOYSA-N.
| Molecular formula | C15H14O6 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (2-ethyl-4-oxopyran-3-yl) 4-hydroxy-3-methoxybenzoate |
| InChIKey | NHGPHSDMEIUFCL-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=O)C=CO1)OC(=O)C2=CC(=C(C=C2)O)OC |
Computed by PubChem (NCBI)