Products 713505-46-5

CAS 713505-46-5 is the registry number for 5-((2-Ethoxy-4-formylphenoxy)methyl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylic acid (CAS 713505-46-5) is a chemical compound with the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. IUPAC name: 5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: BIRICQDUOCHARK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14O6
Molecular weight290.27 g/mol
IUPAC name5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylic acid
InChIKeyBIRICQDUOCHARK-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C=O)OCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)