CAS 2088735-51-5 appears in our catalog under these names: FLT3–IN–10, FLT3-IN-10/ 99.6% (existing batch purity), 5-(4-Fluorophenyl)-N-phenyloxazol-2-amine, 98%, 98%, FLT3-IN-10, 98.80%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
5-(4-fluorophenyl)-N-phenyl-1,3-oxazol-2-amine (CAS 2088735-51-5) is a chemical compound with the molecular formula C15H11FN2O and a molecular weight of 254.26 g/mol. IUPAC name: 5-(4-fluorophenyl)-N-phenyl-1,3-oxazol-2-amine. InChIKey: JNXCCEMGDXSTBQ-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O |
|---|---|
| Molecular weight | 254.26 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-N-phenyl-1,3-oxazol-2-amine |
| InChIKey | JNXCCEMGDXSTBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(O2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)