Products 2089-32-9
CAS 2089-32-9 is the registry number for 1-(4-Ethylphenyl)ethanone oxime, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(NZ)-N-[1-(4-ethylphenyl)ethylidene]hydroxylamine (CAS 2089-32-9) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (NZ)-N-[1-(4-ethylphenyl)ethylidene]hydroxylamine. InChIKey: VECGTLCRIQNAIB-FLIBITNWSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (NZ)-N-[1-(4-ethylphenyl)ethylidene]hydroxylamine |
| InChIKey | VECGTLCRIQNAIB-FLIBITNWSA-N |
| SMILES | CCC1=CC=C(C=C1)/C(=N\O)/C |
Computed by PubChem (NCBI)