CAS 2089223-27-6 appears in our catalog under these names: N-([1,1'-Biphenyl]-4-yl)-2'-(9H-carbazol-9-yl)-[1,1'-biphenyl]-4-amine, 98%, 98%, N-([1,1'-Biphenyl]-4-yl)-2'-(9H-carbazol-9-yl)-[1,1'-biphenyl]-4-amine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
N-[4-(2-carbazol-9-ylphenyl)phenyl]-4-phenylaniline (CAS 2089223-27-6) is a chemical compound with the molecular formula C36H26N2 and a molecular weight of 486.6 g/mol. IUPAC name: N-[4-(2-carbazol-9-ylphenyl)phenyl]-4-phenylaniline. InChIKey: CDKIFBDQGZMZAZ-UHFFFAOYSA-N.
| Molecular formula | C36H26N2 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | N-[4-(2-carbazol-9-ylphenyl)phenyl]-4-phenylaniline |
| InChIKey | CDKIFBDQGZMZAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=CC=C4N5C6=CC=CC=C6C7=CC=CC=C75 |
Computed by PubChem (NCBI)