CAS 2160539-20-6 appears in our catalog under these names: 3,3'-((2,2-Diphenylethene-1,1-diyl)bis(4,1-phenylene))dipyridine, 95%, 3,3'-((2,2-Diphenylethene-1,1-diyl)bis(4,1-phenylene))dipyridine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3-[4-[2,2-diphenyl-1-(4-pyridin-3-ylphenyl)ethenyl]phenyl]pyridine (CAS 2160539-20-6) is a chemical compound with the molecular formula C36H26N2 and a molecular weight of 486.6 g/mol. IUPAC name: 3-[4-[2,2-diphenyl-1-(4-pyridin-3-ylphenyl)ethenyl]phenyl]pyridine. InChIKey: VEBWILBLNUGVTC-UHFFFAOYSA-N.
| Molecular formula | C36H26N2 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 3-[4-[2,2-diphenyl-1-(4-pyridin-3-ylphenyl)ethenyl]phenyl]pyridine |
| InChIKey | VEBWILBLNUGVTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)C3=CN=CC=C3)C4=CC=C(C=C4)C5=CN=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)