Products 2089251-73-8
CAS 2089251-73-8 appears in our catalog under these names: Decan-2-yl 8-((8-(heptadecan-9-yloxy)-8-oxooctyl)(2-hydroxyethyl)amino)octanoate, 95%, L14, 97%, 97%, LNP Lipid-48, 97.0%, LNP Lipid-48, 95%, L14, 97%. Offered by: BLDpharm, Chemat, MedChemExpress, Ambeed, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg, 100 mg.
Decan-2-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate (CAS 2089251-73-8) is a chemical compound with the molecular formula C45H89NO5 and a molecular weight of 724.2 g/mol. IUPAC name: decan-2-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate. InChIKey: BPRGRMGYJPIPFS-UHFFFAOYSA-N.
| Molecular formula | C45H89NO5 |
|---|---|
| Molecular weight | 724.2 g/mol |
| IUPAC name | decan-2-yl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate |
| InChIKey | BPRGRMGYJPIPFS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(C)OC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCO |
Computed by PubChem (NCBI)