Products 2089277-76-7

CAS 2089277-76-7 is the registry number for 3-{2-Azabicyclo(2.1.1)hexan-1-yl}propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2-azabicyclo[2.1.1]hexan-1-yl)propanoic acid;hydrochloride (CAS 2089277-76-7) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 3-(2-azabicyclo[2.1.1]hexan-1-yl)propanoic acid;hydrochloride. InChIKey: DMGVNYLSHHNXAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC name3-(2-azabicyclo[2.1.1]hexan-1-yl)propanoic acid;hydrochloride
InChIKeyDMGVNYLSHHNXAZ-UHFFFAOYSA-N
SMILESC1C2CC1(NC2)CCC(=O)O.Cl

Computed by PubChem (NCBI)