CAS 2089301-60-8 appears in our catalog under these names: tert-Butyl 5-nitro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, 97%, 97%, tert-Butyl 5-nitro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 5-nitro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 2089301-60-8) is a chemical compound with the molecular formula C17H21N3O5 and a molecular weight of 347.4 g/mol. IUPAC name: tert-butyl 5-nitro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: PEFQNQAJNHUFQQ-UHFFFAOYSA-N.
| Molecular formula | C17H21N3O5 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | tert-butyl 5-nitro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | PEFQNQAJNHUFQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC(=C3)[N+](=O)[O-])NC2=O |
Computed by PubChem (NCBI)