Products 73167-84-7
CAS 73167-84-7 is the registry number for Bz-Gly-Ala-Pro (Hippuryl-Alanyl-Proline). Offered by: Biosynth. Available pack sizes: 1g, 0,1g.
(2S)-1-[(2S)-2-[(2-benzamidoacetyl)amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 73167-84-7) is a chemical compound with the molecular formula C17H21N3O5 and a molecular weight of 347.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-[(2-benzamidoacetyl)amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: CGQQXKITRPZKCI-AAEUAGOBSA-N.
| Molecular formula | C17H21N3O5 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[(2-benzamidoacetyl)amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CGQQXKITRPZKCI-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)CNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)