CAS 2089319-25-3 appears in our catalog under these names: (3,5–Dichloropyrazin–2–yl)methanamine hydrochloride, (3,5-Dichloropyrazin-2-yl)methanamine hydrochloride, (3,5-Dichloropyrazin-2-yl)methanamine hydrochloride, 95%, 95%, (3,5-Dichloropyrazin-2-yl)methanamine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 0,5g, 100mg, 250mg, 1g.
(3,5-dichloropyrazin-2-yl)methanamine;hydrochloride (CAS 2089319-25-3) is a chemical compound with the molecular formula C5H6Cl3N3 and a molecular weight of 214.48 g/mol. IUPAC name: (3,5-dichloropyrazin-2-yl)methanamine;hydrochloride. InChIKey: JKXFZGOEXKUZKY-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl3N3 |
|---|---|
| Molecular weight | 214.48 g/mol |
| IUPAC name | (3,5-dichloropyrazin-2-yl)methanamine;hydrochloride |
| InChIKey | JKXFZGOEXKUZKY-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)CN)Cl)Cl.Cl |
Computed by PubChem (NCBI)