CAS 89603-10-1 is the registry number for 3,4-Diamino-2,6-dichloropyridine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloropyridine-3,4-diamine;hydrochloride (CAS 89603-10-1) is a chemical compound with the molecular formula C5H6Cl3N3 and a molecular weight of 214.48 g/mol. IUPAC name: 2,6-dichloropyridine-3,4-diamine;hydrochloride. InChIKey: QAIXRYPWWNMNRQ-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl3N3 |
|---|---|
| Molecular weight | 214.48 g/mol |
| IUPAC name | 2,6-dichloropyridine-3,4-diamine;hydrochloride |
| InChIKey | QAIXRYPWWNMNRQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)N)N.Cl |
Computed by PubChem (NCBI)