CAS 2089327-39-7 is the registry number for Thiazolo[5,4-b]pyridin-2-ylmethanamine hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,3]thiazolo[5,4-b]pyridin-2-ylmethanamine;hydrochloride (CAS 2089327-39-7) is a chemical compound with the molecular formula C7H8ClN3S and a molecular weight of 201.68 g/mol. IUPAC name: [1,3]thiazolo[5,4-b]pyridin-2-ylmethanamine;hydrochloride. InChIKey: HFAOMVZFEMGCRE-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3S |
|---|---|
| Molecular weight | 201.68 g/mol |
| IUPAC name | [1,3]thiazolo[5,4-b]pyridin-2-ylmethanamine;hydrochloride |
| InChIKey | HFAOMVZFEMGCRE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C1)SC(=N2)CN.Cl |
Computed by PubChem (NCBI)