CAS 828-11-5 is the registry number for ((3-Chlorophenyl)amino)thiourea, 90%. Offered by: AmBeed. Available pack sizes: 1g.
(3-chloroanilino)thiourea (CAS 828-11-5) is a chemical compound with the molecular formula C7H8ClN3S and a molecular weight of 201.68 g/mol. IUPAC name: (3-chloroanilino)thiourea. InChIKey: NBFHOAYQGXDQDR-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3S |
|---|---|
| Molecular weight | 201.68 g/mol |
| IUPAC name | (3-chloroanilino)thiourea |
| InChIKey | NBFHOAYQGXDQDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NNC(=S)N |
Computed by PubChem (NCBI)