Products 2089377-90-0

CAS 2089377-90-0 is the registry number for Methyl 3,5-dimethylisonicotinate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3,5-dimethylpyridine-4-carboxylate (CAS 2089377-90-0) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: methyl 3,5-dimethylpyridine-4-carboxylate. InChIKey: SFNOOJZHFJCBAX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight165.19 g/mol
IUPAC namemethyl 3,5-dimethylpyridine-4-carboxylate
InChIKeySFNOOJZHFJCBAX-UHFFFAOYSA-N
SMILESCC1=CN=CC(=C1C(=O)OC)C

Computed by PubChem (NCBI)