CAS 2089580-30-1 appears in our catalog under these names: (3S,4R,5S)-Thiane-2,3,4,5-tetrol, 95%, (3S,4R,5S)-Thiane-2,3,4,5-tetrol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(3S,4R,5S)-thiane-2,3,4,5-tetrol (CAS 2089580-30-1) is a chemical compound with the molecular formula C5H10O4S and a molecular weight of 166.20 g/mol. IUPAC name: (3S,4R,5S)-thiane-2,3,4,5-tetrol. InChIKey: QWVJFKXOINHVGD-ZRMNMSDTSA-N.
| Molecular formula | C5H10O4S |
|---|---|
| Molecular weight | 166.20 g/mol |
| IUPAC name | (3S,4R,5S)-thiane-2,3,4,5-tetrol |
| InChIKey | QWVJFKXOINHVGD-ZRMNMSDTSA-N |
| SMILES | C1[C@H]([C@H]([C@@H](C(S1)O)O)O)O |
Computed by PubChem (NCBI)