CAS 2089649-38-5 is the registry number for tert-Butyl 3-oxo-4-(4-(trifluoromethoxy)phenyl) piperazine-1-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Tert-butyl 3-oxo-4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate (CAS 2089649-38-5) is a chemical compound with the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. IUPAC name: tert-butyl 3-oxo-4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate. InChIKey: AEUUPCHMRNOLJE-UHFFFAOYSA-N.
| Molecular formula | C16H19F3N2O4 |
|---|---|
| Molecular weight | 360.33 g/mol |
| IUPAC name | tert-butyl 3-oxo-4-[4-(trifluoromethoxy)phenyl]piperazine-1-carboxylate |
| InChIKey | AEUUPCHMRNOLJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)C2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)