CAS 2832911-78-9 is the registry number for Benzyl (2-azaspiro(3.3)heptan-5-yl)carbamate 2,2,2-trifluoroacetate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl N-(2-azaspiro[3.3]heptan-7-yl)carbamate;2,2,2-trifluoroacetic acid (CAS 2832911-78-9) is a chemical compound with the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. IUPAC name: benzyl N-(2-azaspiro[3.3]heptan-7-yl)carbamate;2,2,2-trifluoroacetic acid. InChIKey: TVQIJXXKABCTLX-UHFFFAOYSA-N.
| Molecular formula | C16H19F3N2O4 |
|---|---|
| Molecular weight | 360.33 g/mol |
| IUPAC name | benzyl N-(2-azaspiro[3.3]heptan-7-yl)carbamate;2,2,2-trifluoroacetic acid |
| InChIKey | TVQIJXXKABCTLX-UHFFFAOYSA-N |
| SMILES | C1CC2(C1NC(=O)OCC3=CC=CC=C3)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)