CAS 2089650-74-6 is the registry number for 3-(4-(Trifluoromethyl)phenyl)bicyclo[1.1.0]butane-1-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxylic acid (CAS 2089650-74-6) is a chemical compound with the molecular formula C12H9F3O2 and a molecular weight of 242.19 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxylic acid. InChIKey: WYJCLAGNAXGQAP-UHFFFAOYSA-N.
| Molecular formula | C12H9F3O2 |
|---|---|
| Molecular weight | 242.19 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]bicyclo[1.1.0]butane-1-carboxylic acid |
| InChIKey | WYJCLAGNAXGQAP-UHFFFAOYSA-N |
| SMILES | C1C2(C1(C2)C(=O)O)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)