CAS 2381248-00-4 is the registry number for 2,2-Difluoro-3-(4-fluorophenyl)bicyclo(1.1.1)pentane-1-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2,2-difluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2381248-00-4) is a chemical compound with the molecular formula C12H9F3O2 and a molecular weight of 242.19 g/mol. IUPAC name: 2,2-difluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: SJWRESOFSDEKGS-UHFFFAOYSA-N.
| Molecular formula | C12H9F3O2 |
|---|---|
| Molecular weight | 242.19 g/mol |
| IUPAC name | 2,2-difluoro-3-(4-fluorophenyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | SJWRESOFSDEKGS-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2(F)F)C(=O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)