CAS 2089650-87-1 is the registry number for Methyl 4-amino-7-bromoisochroman-4-carboxylate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-amino-7-bromo-1,3-dihydroisochromene-4-carboxylate;hydrochloride (CAS 2089650-87-1) is a chemical compound with the molecular formula C11H13BrClNO3 and a molecular weight of 322.58 g/mol. IUPAC name: methyl 4-amino-7-bromo-1,3-dihydroisochromene-4-carboxylate;hydrochloride. InChIKey: CDCPEQWYAIRSCX-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO3 |
|---|---|
| Molecular weight | 322.58 g/mol |
| IUPAC name | methyl 4-amino-7-bromo-1,3-dihydroisochromene-4-carboxylate;hydrochloride |
| InChIKey | CDCPEQWYAIRSCX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(COCC2=C1C=CC(=C2)Br)N.Cl |
Computed by PubChem (NCBI)