Products 477772-67-1
CAS 477772-67-1 is the registry number for 5-Bromo-2-chloro-n-(2,2-dimethoxyethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-chloro-N-(2,2-dimethoxyethyl)benzamide (CAS 477772-67-1) is a chemical compound with the molecular formula C11H13BrClNO3 and a molecular weight of 322.58 g/mol. IUPAC name: 5-bromo-2-chloro-N-(2,2-dimethoxyethyl)benzamide. InChIKey: ODPXKQQMCZZCFQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO3 |
|---|---|
| Molecular weight | 322.58 g/mol |
| IUPAC name | 5-bromo-2-chloro-N-(2,2-dimethoxyethyl)benzamide |
| InChIKey | ODPXKQQMCZZCFQ-UHFFFAOYSA-N |
| SMILES | COC(CNC(=O)C1=C(C=CC(=C1)Br)Cl)OC |
Computed by PubChem (NCBI)