CAS 2089671-27-0 appears in our catalog under these names: (2R)-2-Amino-2-(6-chloro(3-pyridyl))ethan-1-ol hydrochloride, 95%, (2R)-2-AMINO-2-(6-CHLORO(3-PYRIDYL))ETHAN-1-OL HCL, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;hydrochloride (CAS 2089671-27-0) is a chemical compound with the molecular formula C7H10Cl2N2O and a molecular weight of 209.07 g/mol. IUPAC name: (2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;hydrochloride. InChIKey: PIOARNGHMWBQRB-RGMNGODLSA-N.
| Molecular formula | C7H10Cl2N2O |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | (2R)-2-amino-2-(6-chloro-3-pyridinyl)ethanol;hydrochloride |
| InChIKey | PIOARNGHMWBQRB-RGMNGODLSA-N |
| SMILES | C1=CC(=NC=C1[C@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)