CAS 51746-81-7 appears in our catalog under these names: 2-Amino-1-(pyridin-2-yl)ethanone dihydrochloride, 95+%, 2-(2-Aminoacetyl)pyridine Dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-pyridin-2-ylethanone;dihydrochloride (CAS 51746-81-7) is a chemical compound with the molecular formula C7H10Cl2N2O and a molecular weight of 209.07 g/mol. IUPAC name: 2-amino-1-pyridin-2-ylethanone;dihydrochloride. InChIKey: XDMZXKYLIWGXSA-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O |
|---|---|
| Molecular weight | 209.07 g/mol |
| IUPAC name | 2-amino-1-pyridin-2-ylethanone;dihydrochloride |
| InChIKey | XDMZXKYLIWGXSA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)CN.Cl.Cl |
Computed by PubChem (NCBI)