Products 208994-12-1

CAS 208994-12-1 is the registry number for 3-Amino-6-chloro-thieno[3,2-b]pyridine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate (CAS 208994-12-1) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: methyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate. InChIKey: CJTHRTORVFJNHH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClN2O2S
Molecular weight242.68 g/mol
IUPAC namemethyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate
InChIKeyCJTHRTORVFJNHH-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C2=C(S1)C=C(C=N2)Cl)N

Computed by PubChem (NCBI)