CAS 208994-12-1 is the registry number for 3-Amino-6-chloro-thieno[3,2-b]pyridine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate (CAS 208994-12-1) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: methyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate. InChIKey: CJTHRTORVFJNHH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | methyl 3-amino-6-chlorothieno[3,2-b]pyridine-2-carboxylate |
| InChIKey | CJTHRTORVFJNHH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=C(C=N2)Cl)N |
Computed by PubChem (NCBI)