CAS 58695-63-9 appears in our catalog under these names: 5-(2-Chloro-phenoxymethyl)-[1,3,4]oxadiazole-2-thiol, 95%, 5-((2-Chlorophenoxy)methyl)-1,3,4-oxadiazole-2-thiol, 97%, 5-(2-Chlorophenoxymethyl)-1,3,4-oxadiazole-2-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 0,5g.
5-[(2-chlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 58695-63-9) is a chemical compound with the molecular formula C9H7ClN2O2S and a molecular weight of 242.68 g/mol. IUPAC name: 5-[(2-chlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: VHRAIEILHYCYLA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2S |
|---|---|
| Molecular weight | 242.68 g/mol |
| IUPAC name | 5-[(2-chlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | VHRAIEILHYCYLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC2=NNC(=S)O2)Cl |
Computed by PubChem (NCBI)