CAS 208994-28-9 is the registry number for rac-(2R,6S)-8-Oxa-4-azatricyclo(7.4.0.0,2,6)trideca-1(13),9,11-triene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3aS,9bR)-1,2,3,3a,4,9b-hexahydrochromeno[3,4-c]pyrrole (CAS 208994-28-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: (3aS,9bR)-1,2,3,3a,4,9b-hexahydrochromeno[3,4-c]pyrrole. InChIKey: FJCAHIFUCPXKCU-WCBMZHEXSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (3aS,9bR)-1,2,3,3a,4,9b-hexahydrochromeno[3,4-c]pyrrole |
| InChIKey | FJCAHIFUCPXKCU-WCBMZHEXSA-N |
| SMILES | C1[C@H]2COC3=CC=CC=C3[C@@H]2CN1 |
Computed by PubChem (NCBI)